C11H17N5O3 — CID 104568194
4-[2-(2-methoxyethoxy)ethoxy]-N-methyl-1H-pyrazolo[5,4-d]pyrimidin-6-amine (PubChem CID 104568194) has the molecular formula C11H17N5O3 and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-[2-(2-methoxyethoxy)ethoxy]-N-methyl-1H-pyrazolo[5,4-d]pyrimidin-6-amine.
| Compound Name | 4-[2-(2-methoxyethoxy)ethoxy]-N-methyl-1H-pyrazolo[5,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 104568194 |
| Molecular Formula | C11H17N5O3 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-[2-(2-methoxyethoxy)ethoxy]-N-methyl-1H-pyrazolo[5,4-d]pyrimidin-6-amine |
| SMILES | CNc1nc(OCCOCCOC)c2cn[nH]c2n1 |
| InChI | InChI=1S/C11H17N5O3/c1-12-11-14-9-8(7-13-16-9)10(15-11)19-6-5-18-4-3-17-2/h7H,3-6H2,1-2H3,(H2,12,13,14,15,16) |
| InChIKey | CDEJACKYLFPBNR-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|