About 5,9-bis(2-methoxyethoxy)-3H-pyrazolo[5,4-c]isoquinoline
5,9-bis(2-methoxyethoxy)-3H-pyrazolo[5,4-c]isoquinoline (PubChem CID 123333746) has the molecular formula C16H19N3O4
and a molecular weight of 317.35 g/mol. Its IUPAC name is 5,9-bis(2-methoxyethoxy)-3H-pyrazolo[5,4-c]isoquinoline.
Molecular Properties
| Compound Name | 5,9-bis(2-methoxyethoxy)-3H-pyrazolo[5,4-c]isoquinoline |
| PubChem CID | 123333746 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 5,9-bis(2-methoxyethoxy)-3H-pyrazolo[5,4-c]isoquinoline |
| SMILES | COCCOc1nc2[nH]ncc2c2c(OCCOC)cccc12 |
| InChI | InChI=1S/C16H19N3O4/c1-20-6-8-22-13-5-3-4-11-14(13)12-10-17-19-15(12)18-16(11)23-9-7-21-2/h3-5,10H,6-9H2,1-2H3,(H,17,18,19) |
| InChIKey | WLGXXGMMGPUNTB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5,9-bis(2-methoxyethoxy)-3H-pyrazolo[5,4-c]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,9-bis(2-methoxyethoxy)-3H-pyrazolo[5,4-c]isoquinoline?
The IUPAC name of 5,9-bis(2-methoxyethoxy)-3H-pyrazolo[5,4-c]isoquinoline (CID 123333746) is 5,9-bis(2-methoxyethoxy)-3H-pyrazolo[5,4-c]isoquinoline.
What is the SMILES notation for 5,9-bis(2-methoxyethoxy)-3H-pyrazolo[5,4-c]isoquinoline?
The canonical SMILES for 5,9-bis(2-methoxyethoxy)-3H-pyrazolo[5,4-c]isoquinoline is COCCOc1nc2[nH]ncc2c2c(OCCOC)cccc12.
What is the InChIKey of 5,9-bis(2-methoxyethoxy)-3H-pyrazolo[5,4-c]isoquinoline?
The InChIKey is WLGXXGMMGPUNTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O4/c1-20-6-8-22-13-5-3-4-11-14(13)12-10-17-19-15(12)18-16(11)23-9-7-21-2/h3-5,10H,6-9H2,1-2H3,(H,17,18,19).
What are the key properties of 5,9-bis(2-methoxyethoxy)-3H-pyrazolo[5,4-c]isoquinoline?
5,9-bis(2-methoxyethoxy)-3H-pyrazolo[5,4-c]isoquinoline has a molecular weight of 317.35 g/mol, XLogP of 2.16, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,9-bis(2-methoxyethoxy)-3H-pyrazolo[5,4-c]isoquinoline is sourced from PubChem (CID 123333746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).