C11H14N4O2 — CID 11637233
5-(2-methoxyethoxy)quinazoline-2,4-diamine (PubChem CID 11637233) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 5-(2-methoxyethoxy)quinazoline-2,4-diamine.
| Compound Name | 5-(2-methoxyethoxy)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 11637233 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 5-(2-methoxyethoxy)quinazoline-2,4-diamine |
| SMILES | COCCOc1cccc2nc(N)nc(N)c12 |
| InChI | InChI=1S/C11H14N4O2/c1-16-5-6-17-8-4-2-3-7-9(8)10(12)15-11(13)14-7/h2-4H,5-6H2,1H3,(H4,12,13,14,15) |
| InChIKey | DEXAUZQLNWCCTO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|