C15H23N3O7S — CID 161275522
2,5-bis(2-methoxyethoxy)quinazolin-4-amine;methanesulfonic acid (PubChem CID 161275522) has the molecular formula C15H23N3O7S and a molecular weight of 389.43 g/mol. Its IUPAC name is 2,5-bis(2-methoxyethoxy)quinazolin-4-amine;methanesulfonic acid.
| Compound Name | 2,5-bis(2-methoxyethoxy)quinazolin-4-amine;methanesulfonic acid |
|---|---|
| PubChem CID | 161275522 |
| Molecular Formula | C15H23N3O7S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2,5-bis(2-methoxyethoxy)quinazolin-4-amine;methanesulfonic acid |
| SMILES | COCCOc1nc(N)c2c(OCCOC)cccc2n1.CS(=O)(=O)O |
| InChI | InChI=1S/C14H19N3O4.CH4O3S/c1-18-6-8-20-11-5-3-4-10-12(11)13(15)17-14(16-10)21-9-7-19-2;1-5(2,3)4/h3-5H,6-9H2,1-2H3,(H2,15,16,17);1H3,(H,2,3,4) |
| InChIKey | VEJVAHIUSGDDKA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 143.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|