C17H18N4O3 — CID 66924159
5-[(3,4-dimethoxyphenyl)methoxy]quinazoline-2,4-diamine (PubChem CID 66924159) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 5-[(3,4-dimethoxyphenyl)methoxy]quinazoline-2,4-diamine.
| Compound Name | 5-[(3,4-dimethoxyphenyl)methoxy]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 66924159 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 5-[(3,4-dimethoxyphenyl)methoxy]quinazoline-2,4-diamine |
| SMILES | COc1ccc(COc2cccc3nc(N)nc(N)c23)cc1OC |
| InChI | InChI=1S/C17H18N4O3/c1-22-12-7-6-10(8-14(12)23-2)9-24-13-5-3-4-11-15(13)16(18)21-17(19)20-11/h3-8H,9H2,1-2H3,(H4,18,19,20,21) |
| InChIKey | ULRYHKOKUUPPLO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |