C11H19FN4O4 — CID 104568409
[5-fluoro-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]pyrimidin-2-yl]hydrazine (PubChem CID 104568409) has the molecular formula C11H19FN4O4 and a molecular weight of 290.29 g/mol. Its IUPAC name is [5-fluoro-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]pyrimidin-2-yl]hydrazine.
| Compound Name | [5-fluoro-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 104568409 |
| Molecular Formula | C11H19FN4O4 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | [5-fluoro-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]pyrimidin-2-yl]hydrazine |
| SMILES | COCCOCCOCCOc1nc(NN)ncc1F |
| InChI | InChI=1S/C11H19FN4O4/c1-17-2-3-18-4-5-19-6-7-20-10-9(12)8-14-11(15-10)16-13/h8H,2-7,13H2,1H3,(H,14,15,16) |
| InChIKey | JPPVTXNVEWWLAV-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|