C11H12FN5 — CID 80778949
5-fluoro-4-N-(1-pyridin-3-ylethyl)pyrimidine-2,4-diamine (PubChem CID 80778949) has the molecular formula C11H12FN5 and a molecular weight of 233.25 g/mol. Its IUPAC name is 5-fluoro-4-N-(1-pyridin-3-ylethyl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-4-N-(1-pyridin-3-ylethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80778949 |
| Molecular Formula | C11H12FN5 |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 5-fluoro-4-N-(1-pyridin-3-ylethyl)pyrimidine-2,4-diamine |
| SMILES | CC(Nc1nc(N)ncc1F)c1cccnc1 |
| InChI | InChI=1S/C11H12FN5/c1-7(8-3-2-4-14-5-8)16-10-9(12)6-15-11(13)17-10/h2-7H,1H3,(H3,13,15,16,17) |
| InChIKey | XJDGVCJEHCWLAC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |