C25H22Cl2N2O3 — CID 68555862
N-(2,4-dichloro-5-methoxyphenyl)-7-[4-(1-methoxyethoxy)phenyl]quinolin-4-amine (PubChem CID 68555862) has the molecular formula C25H22Cl2N2O3 and a molecular weight of 469.37 g/mol. Its IUPAC name is N-(2,4-dichloro-5-methoxyphenyl)-7-[4-(1-methoxyethoxy)phenyl]quinolin-4-amine.
| Compound Name | N-(2,4-dichloro-5-methoxyphenyl)-7-[4-(1-methoxyethoxy)phenyl]quinolin-4-amine |
|---|---|
| PubChem CID | 68555862 |
| Molecular Formula | C25H22Cl2N2O3 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | N-(2,4-dichloro-5-methoxyphenyl)-7-[4-(1-methoxyethoxy)phenyl]quinolin-4-amine |
| SMILES | COc1cc(Nc2ccnc3cc(-c4ccc(OC(C)OC)cc4)ccc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C25H22Cl2N2O3/c1-15(30-2)32-18-7-4-16(5-8-18)17-6-9-19-22(10-11-28-23(19)12-17)29-24-14-25(31-3)21(27)13-20(24)26/h4-15H,1-3H3,(H,28,29) |
| InChIKey | VTNFYWXKGNULPJ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|