C30H27N3O3S — CID 164620647
7-(4-methylsulfonylphenyl)-N-[2-(4-propan-2-yloxyphenyl)-4-pyridinyl]quinolin-4-amine (PubChem CID 164620647) has the molecular formula C30H27N3O3S and a molecular weight of 509.63 g/mol. Its IUPAC name is 7-(4-methylsulfonylphenyl)-N-[2-(4-propan-2-yloxyphenyl)-4-pyridinyl]quinolin-4-amine.
| Compound Name | 7-(4-methylsulfonylphenyl)-N-[2-(4-propan-2-yloxyphenyl)-4-pyridinyl]quinolin-4-amine |
|---|---|
| PubChem CID | 164620647 |
| Molecular Formula | C30H27N3O3S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 7-(4-methylsulfonylphenyl)-N-[2-(4-propan-2-yloxyphenyl)-4-pyridinyl]quinolin-4-amine |
| SMILES | CC(C)Oc1ccc(-c2cc(Nc3ccnc4cc(-c5ccc(S(C)(=O)=O)cc5)ccc34)ccn2)cc1 |
| InChI | InChI=1S/C30H27N3O3S/c1-20(2)36-25-9-4-22(5-10-25)29-19-24(14-16-31-29)33-28-15-17-32-30-18-23(8-13-27(28)30)21-6-11-26(12-7-21)37(3,34)35/h4-20H,1-3H3,(H,31,32,33) |
| InChIKey | CDPNFJNZLHNIHC-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |