C17H13FN4O2S — CID 67466931
N-(3-fluoro-2H-indazol-6-yl)-6-methylsulfonylquinolin-4-amine (PubChem CID 67466931) has the molecular formula C17H13FN4O2S and a molecular weight of 356.38 g/mol. Its IUPAC name is N-(3-fluoro-2H-indazol-6-yl)-6-methylsulfonylquinolin-4-amine.
| Compound Name | N-(3-fluoro-2H-indazol-6-yl)-6-methylsulfonylquinolin-4-amine |
|---|---|
| PubChem CID | 67466931 |
| Molecular Formula | C17H13FN4O2S |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | N-(3-fluoro-2H-indazol-6-yl)-6-methylsulfonylquinolin-4-amine |
| SMILES | CS(=O)(=O)c1ccc2nccc(Nc3ccc4c(F)[nH]nc4c3)c2c1 |
| InChI | InChI=1S/C17H13FN4O2S/c1-25(23,24)11-3-5-14-13(9-11)15(6-7-19-14)20-10-2-4-12-16(8-10)21-22-17(12)18/h2-9H,1H3,(H,19,20)(H,21,22) |
| InChIKey | JHDHUVDBAFNZNH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |