C20H19FN4O2S — CID 67468809
6-tert-butylsulfonyl-N-(3-fluoro-2H-indazol-6-yl)quinolin-4-amine (PubChem CID 67468809) has the molecular formula C20H19FN4O2S and a molecular weight of 398.46 g/mol. Its IUPAC name is 6-tert-butylsulfonyl-N-(3-fluoro-2H-indazol-6-yl)quinolin-4-amine.
| Compound Name | 6-tert-butylsulfonyl-N-(3-fluoro-2H-indazol-6-yl)quinolin-4-amine |
|---|---|
| PubChem CID | 67468809 |
| Molecular Formula | C20H19FN4O2S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 6-tert-butylsulfonyl-N-(3-fluoro-2H-indazol-6-yl)quinolin-4-amine |
| SMILES | CC(C)(C)S(=O)(=O)c1ccc2nccc(Nc3ccc4c(F)[nH]nc4c3)c2c1 |
| InChI | InChI=1S/C20H19FN4O2S/c1-20(2,3)28(26,27)13-5-7-16-15(11-13)17(8-9-22-16)23-12-4-6-14-18(10-12)24-25-19(14)21/h4-11H,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | AXZXTVROJAFQLE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |