C18H16FN3O2S — CID 39850795
4-[(6-fluoroquinolin-4-yl)amino]-N-prop-2-enylbenzenesulfonamide (PubChem CID 39850795) has the molecular formula C18H16FN3O2S and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-[(6-fluoroquinolin-4-yl)amino]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-[(6-fluoroquinolin-4-yl)amino]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 39850795 |
| Molecular Formula | C18H16FN3O2S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 4-[(6-fluoroquinolin-4-yl)amino]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(Nc2ccnc3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C18H16FN3O2S/c1-2-10-21-25(23,24)15-6-4-14(5-7-15)22-18-9-11-20-17-8-3-13(19)12-16(17)18/h2-9,11-12,21H,1,10H2,(H,20,22) |
| InChIKey | GJVVODZIMNKSCB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|