C28H25FN6O — CID 157043478
N-[3-[(2-amino-4-pyridinyl)amino]phenyl]formamide;6-fluoro-N-(4-methylphenyl)quinolin-4-amine (PubChem CID 157043478) has the molecular formula C28H25FN6O and a molecular weight of 480.55 g/mol. Its IUPAC name is N-[3-[(2-amino-4-pyridinyl)amino]phenyl]formamide;6-fluoro-N-(4-methylphenyl)quinolin-4-amine.
| Compound Name | N-[3-[(2-amino-4-pyridinyl)amino]phenyl]formamide;6-fluoro-N-(4-methylphenyl)quinolin-4-amine |
|---|---|
| PubChem CID | 157043478 |
| Molecular Formula | C28H25FN6O |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | N-[3-[(2-amino-4-pyridinyl)amino]phenyl]formamide;6-fluoro-N-(4-methylphenyl)quinolin-4-amine |
| SMILES | Cc1ccc(Nc2ccnc3ccc(F)cc23)cc1.Nc1cc(Nc2cccc(NC=O)c2)ccn1 |
| InChI | InChI=1S/C16H13FN2.C12H12N4O/c1-11-2-5-13(6-3-11)19-16-8-9-18-15-7-4-12(17)10-14(15)16;13-12-7-11(4-5-14-12)16-10-3-1-2-9(6-10)15-8-17/h2-10H,1H3,(H,18,19);1-8H,(H,15,17)(H3,13,14,16) |
| InChIKey | KXINBQDCVSHAJZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|