C28H28FN5O — CID 157042912
N-[3-(2,6-diazaspiro[3.3]heptan-2-yl)phenyl]formamide;6-fluoro-N-(3-methylphenyl)quinolin-4-amine (PubChem CID 157042912) has the molecular formula C28H28FN5O and a molecular weight of 469.56 g/mol. Its IUPAC name is N-[3-(2,6-diazaspiro[3.3]heptan-2-yl)phenyl]formamide;6-fluoro-N-(3-methylphenyl)quinolin-4-amine.
| Compound Name | N-[3-(2,6-diazaspiro[3.3]heptan-2-yl)phenyl]formamide;6-fluoro-N-(3-methylphenyl)quinolin-4-amine |
|---|---|
| PubChem CID | 157042912 |
| Molecular Formula | C28H28FN5O |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | N-[3-(2,6-diazaspiro[3.3]heptan-2-yl)phenyl]formamide;6-fluoro-N-(3-methylphenyl)quinolin-4-amine |
| SMILES | Cc1cccc(Nc2ccnc3ccc(F)cc23)c1.O=CNc1cccc(N2CC3(CNC3)C2)c1 |
| InChI | InChI=1S/C16H13FN2.C12H15N3O/c1-11-3-2-4-13(9-11)19-16-7-8-18-15-6-5-12(17)10-14(15)16;16-9-14-10-2-1-3-11(4-10)15-7-12(8-15)5-13-6-12/h2-10H,1H3,(H,18,19);1-4,9,13H,5-8H2,(H,14,16) |
| InChIKey | YYWHYXKYKKDVAS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|