C27H26FN5O — CID 166834688
3-[(6-fluoroquinolin-4-yl)amino]-N-[3-(piperidin-4-ylamino)phenyl]benzamide (PubChem CID 166834688) has the molecular formula C27H26FN5O and a molecular weight of 455.54 g/mol. Its IUPAC name is 3-[(6-fluoroquinolin-4-yl)amino]-N-[3-(piperidin-4-ylamino)phenyl]benzamide.
| Compound Name | 3-[(6-fluoroquinolin-4-yl)amino]-N-[3-(piperidin-4-ylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 166834688 |
| Molecular Formula | C27H26FN5O |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 3-[(6-fluoroquinolin-4-yl)amino]-N-[3-(piperidin-4-ylamino)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(NC2CCNCC2)c1)c1cccc(Nc2ccnc3ccc(F)cc23)c1 |
| InChI | InChI=1S/C27H26FN5O/c28-19-7-8-25-24(16-19)26(11-14-30-25)32-21-4-1-3-18(15-21)27(34)33-23-6-2-5-22(17-23)31-20-9-12-29-13-10-20/h1-8,11,14-17,20,29,31H,9-10,12-13H2,(H,30,32)(H,33,34) |
| InChIKey | HLOBFBURSGLLAF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |