C29H23FN4O — CID 170001846
N-(3-anilinophenyl)-3-[(6-fluoroquinolin-4-yl)amino]-2-methylbenzamide (PubChem CID 170001846) has the molecular formula C29H23FN4O and a molecular weight of 462.53 g/mol. Its IUPAC name is N-(3-anilinophenyl)-3-[(6-fluoroquinolin-4-yl)amino]-2-methylbenzamide.
| Compound Name | N-(3-anilinophenyl)-3-[(6-fluoroquinolin-4-yl)amino]-2-methylbenzamide |
|---|---|
| PubChem CID | 170001846 |
| Molecular Formula | C29H23FN4O |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-(3-anilinophenyl)-3-[(6-fluoroquinolin-4-yl)amino]-2-methylbenzamide |
| SMILES | Cc1c(Nc2ccnc3ccc(F)cc23)cccc1C(=O)Nc1cccc(Nc2ccccc2)c1 |
| InChI | InChI=1S/C29H23FN4O/c1-19-24(29(35)33-23-10-5-9-22(18-23)32-21-7-3-2-4-8-21)11-6-12-26(19)34-28-15-16-31-27-14-13-20(30)17-25(27)28/h2-18,32H,1H3,(H,31,34)(H,33,35) |
| InChIKey | AQRAUSQVSOHZKP-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |