C26H20FN5O2S — CID 157043714
N-[4-[(6-fluoroquinolin-4-yl)amino]phenyl]-3-(pyridin-4-ylamino)benzenesulfonamide (PubChem CID 157043714) has the molecular formula C26H20FN5O2S and a molecular weight of 485.54 g/mol. Its IUPAC name is N-[4-[(6-fluoroquinolin-4-yl)amino]phenyl]-3-(pyridin-4-ylamino)benzenesulfonamide.
| Compound Name | N-[4-[(6-fluoroquinolin-4-yl)amino]phenyl]-3-(pyridin-4-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 157043714 |
| Molecular Formula | C26H20FN5O2S |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | N-[4-[(6-fluoroquinolin-4-yl)amino]phenyl]-3-(pyridin-4-ylamino)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Nc2ccnc3ccc(F)cc23)cc1)c1cccc(Nc2ccncc2)c1 |
| InChI | InChI=1S/C26H20FN5O2S/c27-18-4-9-25-24(16-18)26(12-15-29-25)31-19-5-7-21(8-6-19)32-35(33,34)23-3-1-2-22(17-23)30-20-10-13-28-14-11-20/h1-17,32H,(H,28,30)(H,29,31) |
| InChIKey | QNAOMWKPRGQHLY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |