C22H16Cl2N2O4 — CID 141358842
4-[4-[2,4-dichloro-5-(trideuteriomethoxy)anilino]-6-methoxyquinolin-7-yl]furan-2-carbaldehyde (PubChem CID 141358842) has the molecular formula C22H16Cl2N2O4 and a molecular weight of 446.30 g/mol. Its IUPAC name is 4-[4-[2,4-dichloro-5-(trideuteriomethoxy)anilino]-6-methoxyquinolin-7-yl]furan-2-carbaldehyde.
| Compound Name | 4-[4-[2,4-dichloro-5-(trideuteriomethoxy)anilino]-6-methoxyquinolin-7-yl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 141358842 |
| Molecular Formula | C22H16Cl2N2O4 |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 4-[4-[2,4-dichloro-5-(trideuteriomethoxy)anilino]-6-methoxyquinolin-7-yl]furan-2-carbaldehyde |
| SMILES | [2H]C([2H])([2H])Oc1cc(Nc2ccnc3cc(-c4coc(C=O)c4)c(OC)cc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C22H16Cl2N2O4/c1-28-21-7-15-18(26-20-9-22(29-2)17(24)8-16(20)23)3-4-25-19(15)6-14(21)12-5-13(10-27)30-11-12/h3-11H,1-2H3,(H,25,26)/i2D3 |
| InChIKey | VUMYZNDKCRSYLD-BMSJAHLVSA-N |
| XLogP | 6.37 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|