C20H15Cl2FN4O2 — CID 155636899
6-(azetidin-3-yloxy)-N-(3,4-dichloro-2-fluorophenyl)-3-isocyano-7-methoxyquinolin-4-amine (PubChem CID 155636899) has the molecular formula C20H15Cl2FN4O2 and a molecular weight of 433.27 g/mol. Its IUPAC name is 6-(azetidin-3-yloxy)-N-(3,4-dichloro-2-fluorophenyl)-3-isocyano-7-methoxyquinolin-4-amine.
| Compound Name | 6-(azetidin-3-yloxy)-N-(3,4-dichloro-2-fluorophenyl)-3-isocyano-7-methoxyquinolin-4-amine |
|---|---|
| PubChem CID | 155636899 |
| Molecular Formula | C20H15Cl2FN4O2 |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 6-(azetidin-3-yloxy)-N-(3,4-dichloro-2-fluorophenyl)-3-isocyano-7-methoxyquinolin-4-amine |
| SMILES | [C-]#[N+]c1cnc2cc(OC)c(OC3CNC3)cc2c1Nc1ccc(Cl)c(Cl)c1F |
| InChI | InChI=1S/C20H15Cl2FN4O2/c1-24-15-9-26-14-6-16(28-2)17(29-10-7-25-8-10)5-11(14)20(15)27-13-4-3-12(21)18(22)19(13)23/h3-6,9-10,25H,7-8H2,2H3,(H,26,27) |
| InChIKey | VADGTQNFTGHIFG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 59.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|