C25H22Cl2N4O3 — CID 155636891
1-[4-[4-(3,4-dichloroanilino)-3-isocyano-7-methoxyquinolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one (PubChem CID 155636891) has the molecular formula C25H22Cl2N4O3 and a molecular weight of 497.38 g/mol. Its IUPAC name is 1-[4-[4-(3,4-dichloroanilino)-3-isocyano-7-methoxyquinolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-(3,4-dichloroanilino)-3-isocyano-7-methoxyquinolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155636891 |
| Molecular Formula | C25H22Cl2N4O3 |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 1-[4-[4-(3,4-dichloroanilino)-3-isocyano-7-methoxyquinolin-6-yl]oxypiperidin-1-yl]prop-2-en-1-one |
| SMILES | [C-]#[N+]c1cnc2cc(OC)c(OC3CCN(C(=O)C=C)CC3)cc2c1Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H22Cl2N4O3/c1-4-24(32)31-9-7-16(8-10-31)34-23-12-17-20(13-22(23)33-3)29-14-21(28-2)25(17)30-15-5-6-18(26)19(27)11-15/h4-6,11-14,16H,1,7-10H2,3H3,(H,29,30) |
| InChIKey | WCLQYNNEJKDPRI-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 68.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|