C26H28Cl2FN3O4 — CID 155669689
tert-butyl 4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinolin-6-yl]oxypiperidine-1-carboxylate (PubChem CID 155669689) has the molecular formula C26H28Cl2FN3O4 and a molecular weight of 536.43 g/mol. Its IUPAC name is tert-butyl 4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinolin-6-yl]oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinolin-6-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 155669689 |
| Molecular Formula | C26H28Cl2FN3O4 |
| Molecular Weight | 536.43 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | tert-butyl 4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinolin-6-yl]oxypiperidine-1-carboxylate |
| SMILES | COc1cc2nccc(Nc3ccc(Cl)c(Cl)c3F)c2cc1OC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C26H28Cl2FN3O4/c1-26(2,3)36-25(33)32-11-8-15(9-12-32)35-22-13-16-18(7-10-30-20(16)14-21(22)34-4)31-19-6-5-17(27)23(28)24(19)29/h5-7,10,13-15H,8-9,11-12H2,1-4H3,(H,30,31) |
| InChIKey | BTYGFKRSHQQZBP-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.43 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|