C23H21Cl2FN4O2 — CID 139443770
4-(3,4-dichloro-2-fluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)oxyquinoline-3-carbonitrile (PubChem CID 139443770) has the molecular formula C23H21Cl2FN4O2 and a molecular weight of 475.35 g/mol. Its IUPAC name is 4-(3,4-dichloro-2-fluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)oxyquinoline-3-carbonitrile.
| Compound Name | 4-(3,4-dichloro-2-fluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)oxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 139443770 |
| Molecular Formula | C23H21Cl2FN4O2 |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 4-(3,4-dichloro-2-fluoroanilino)-7-methoxy-6-(1-methylpiperidin-4-yl)oxyquinoline-3-carbonitrile |
| SMILES | COc1cc2ncc(C#N)c(Nc3ccc(Cl)c(Cl)c3F)c2cc1OC1CCN(C)CC1 |
| InChI | InChI=1S/C23H21Cl2FN4O2/c1-30-7-5-14(6-8-30)32-20-9-15-18(10-19(20)31-2)28-12-13(11-27)23(15)29-17-4-3-16(24)21(25)22(17)26/h3-4,9-10,12,14H,5-8H2,1-2H3,(H,28,29) |
| InChIKey | RPBQWWCUSMNPBV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|