C23H19Cl2FN4O3 — CID 167487807
N-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclobutyl]but-2-ynamide (PubChem CID 167487807) has the molecular formula C23H19Cl2FN4O3 and a molecular weight of 489.33 g/mol. Its IUPAC name is N-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclobutyl]but-2-ynamide.
| Compound Name | N-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclobutyl]but-2-ynamide |
|---|---|
| PubChem CID | 167487807 |
| Molecular Formula | C23H19Cl2FN4O3 |
| Molecular Weight | 489.33 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | N-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxycyclobutyl]but-2-ynamide |
| SMILES | CC#CC(=O)NC1CC(Oc2cc3c(Nc4ccc(Cl)c(Cl)c4F)ncnc3cc2OC)C1 |
| InChI | InChI=1S/C23H19Cl2FN4O3/c1-3-4-20(31)29-12-7-13(8-12)33-19-9-14-17(10-18(19)32-2)27-11-28-23(14)30-16-6-5-15(24)21(25)22(16)26/h5-6,9-13H,7-8H2,1-2H3,(H,29,31)(H,27,28,30) |
| InChIKey | HQQKJSXMELJJID-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.33 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|