C26H30Cl2FN5O3 — CID 167488003
N-(3,4-dichloro-2-fluorophenyl)-7-[2-(dimethylamino)ethoxy]-6-[3-(methylamino)cyclobutyl]oxyquinazolin-4-amine;prop-2-enal (PubChem CID 167488003) has the molecular formula C26H30Cl2FN5O3 and a molecular weight of 550.46 g/mol. Its IUPAC name is N-(3,4-dichloro-2-fluorophenyl)-7-[2-(dimethylamino)ethoxy]-6-[3-(methylamino)cyclobutyl]oxyquinazolin-4-amine;prop-2-enal.
| Compound Name | N-(3,4-dichloro-2-fluorophenyl)-7-[2-(dimethylamino)ethoxy]-6-[3-(methylamino)cyclobutyl]oxyquinazolin-4-amine;prop-2-enal |
|---|---|
| PubChem CID | 167488003 |
| Molecular Formula | C26H30Cl2FN5O3 |
| Molecular Weight | 550.46 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | N-(3,4-dichloro-2-fluorophenyl)-7-[2-(dimethylamino)ethoxy]-6-[3-(methylamino)cyclobutyl]oxyquinazolin-4-amine;prop-2-enal |
| SMILES | C=CC=O.CNC1CC(Oc2cc3c(Nc4ccc(Cl)c(Cl)c4F)ncnc3cc2OCCN(C)C)C1 |
| InChI | InChI=1S/C23H26Cl2FN5O2.C3H4O/c1-27-13-8-14(9-13)33-20-10-15-18(11-19(20)32-7-6-31(2)3)28-12-29-23(15)30-17-5-4-16(24)21(25)22(17)26;1-2-3-4/h4-5,10-14,27H,6-9H2,1-3H3,(H,28,29,30);2-3H,1H2 |
| InChIKey | CGKFULMRRPWILJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|