C27H27Cl2FN4O4 — CID 155267085
1-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxy-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one (PubChem CID 155267085) has the molecular formula C27H27Cl2FN4O4 and a molecular weight of 561.44 g/mol. Its IUPAC name is 1-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxy-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxy-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155267085 |
| Molecular Formula | C27H27Cl2FN4O4 |
| Molecular Weight | 561.44 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | 1-[3-[4-(3,4-dichloro-2-fluoroanilino)-7-(2-methoxyethoxy)quinazolin-6-yl]oxy-8-azabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C2CCC1CC(Oc1cc3c(Nc4ccc(Cl)c(Cl)c4F)ncnc3cc1OCCOC)C2 |
| InChI | InChI=1S/C27H27Cl2FN4O4/c1-3-24(35)34-15-4-5-16(34)11-17(10-15)38-23-12-18-21(13-22(23)37-9-8-36-2)31-14-32-27(18)33-20-7-6-19(28)25(29)26(20)30/h3,6-7,12-17H,1,4-5,8-11H2,2H3,(H,31,32,33) |
| InChIKey | CPRZMPBWLINOCA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.44 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|