C29H30Cl2FN5O3 — CID 149339842
1-[6-[4-(3,4-dichloro-2-fluoroanilino)-7-[(1-methylpyrrolidin-2-yl)methoxy]quinazolin-6-yl]oxy-3-azabicyclo[3.1.1]heptan-3-yl]prop-2-en-1-one (PubChem CID 149339842) has the molecular formula C29H30Cl2FN5O3 and a molecular weight of 586.50 g/mol. Its IUPAC name is 1-[6-[4-(3,4-dichloro-2-fluoroanilino)-7-[(1-methylpyrrolidin-2-yl)methoxy]quinazolin-6-yl]oxy-3-azabicyclo[3.1.1]heptan-3-yl]prop-2-en-1-one.
| Compound Name | 1-[6-[4-(3,4-dichloro-2-fluoroanilino)-7-[(1-methylpyrrolidin-2-yl)methoxy]quinazolin-6-yl]oxy-3-azabicyclo[3.1.1]heptan-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 149339842 |
| Molecular Formula | C29H30Cl2FN5O3 |
| Molecular Weight | 586.50 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | 1-[6-[4-(3,4-dichloro-2-fluoroanilino)-7-[(1-methylpyrrolidin-2-yl)methoxy]quinazolin-6-yl]oxy-3-azabicyclo[3.1.1]heptan-3-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2CC(C1)C2Oc1cc2c(Nc3ccc(Cl)c(Cl)c3F)ncnc2cc1OCC1CCCN1C |
| InChI | InChI=1S/C29H30Cl2FN5O3/c1-3-25(38)37-12-16-9-17(13-37)28(16)40-24-10-19-22(11-23(24)39-14-18-5-4-8-36(18)2)33-15-34-29(19)35-21-7-6-20(30)26(31)27(21)32/h3,6-7,10-11,15-18,28H,1,4-5,8-9,12-14H2,2H3,(H,33,34,35) |
| InChIKey | YDYSAYZMUDWIPF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|