C24H21ClF2N4O5 — CID 59404865
(Z)-4-[4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]-4-oxobut-2-enoic acid (PubChem CID 59404865) has the molecular formula C24H21ClF2N4O5 and a molecular weight of 518.90 g/mol. Its IUPAC name is (Z)-4-[4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 59404865 |
| Molecular Formula | C24H21ClF2N4O5 |
| Molecular Weight | 518.90 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | (Z)-4-[4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]-4-oxobut-2-enoic acid |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3F)c2cc1OC1CCN(C(=O)/C=C\C(=O)O)CC1 |
| InChI | InChI=1S/C24H21ClF2N4O5/c1-35-18-11-17-14(24(29-12-28-17)30-16-3-2-15(26)22(25)23(16)27)10-19(18)36-13-6-8-31(9-7-13)20(32)4-5-21(33)34/h2-5,10-13H,6-9H2,1H3,(H,33,34)(H,28,29,30)/b5-4- |
| InChIKey | RGQZGDIZUHYVKQ-PLNGDYQASA-N |
| XLogP | 4.32 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.90 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|