C24H17Cl3FN5O2 — CID 141482445
1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinolin-6-yl]-3-[(E)-(2,3-dichlorophenyl)methylideneamino]urea (PubChem CID 141482445) has the molecular formula C24H17Cl3FN5O2 and a molecular weight of 532.79 g/mol. Its IUPAC name is 1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinolin-6-yl]-3-[(E)-(2,3-dichlorophenyl)methylideneamino]urea.
| Compound Name | 1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinolin-6-yl]-3-[(E)-(2,3-dichlorophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 141482445 |
| Molecular Formula | C24H17Cl3FN5O2 |
| Molecular Weight | 532.79 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | 1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinolin-6-yl]-3-[(E)-(2,3-dichlorophenyl)methylideneamino]urea |
| SMILES | COc1cc2nccc(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)N/N=C/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C24H17Cl3FN5O2/c1-35-22-11-20-15(19(7-8-29-20)31-14-5-6-18(28)17(26)9-14)10-21(22)32-24(34)33-30-12-13-3-2-4-16(25)23(13)27/h2-12H,1H3,(H,29,31)(H2,32,33,34)/b30-12+ |
| InChIKey | HMGUZRHFXQEEON-PNQUVVCRSA-N |
| XLogP | 7.24 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.79 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|