C18H14N4O2 — CID 157160693
4-[7-methyl-6-(1,3,4-oxadiazol-2-yl)quinolin-4-yl]oxyaniline (PubChem CID 157160693) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 4-[7-methyl-6-(1,3,4-oxadiazol-2-yl)quinolin-4-yl]oxyaniline.
| Compound Name | 4-[7-methyl-6-(1,3,4-oxadiazol-2-yl)quinolin-4-yl]oxyaniline |
|---|---|
| PubChem CID | 157160693 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 4-[7-methyl-6-(1,3,4-oxadiazol-2-yl)quinolin-4-yl]oxyaniline |
| SMILES | Cc1cc2nccc(Oc3ccc(N)cc3)c2cc1-c1nnco1 |
| InChI | InChI=1S/C18H14N4O2/c1-11-8-16-15(9-14(11)18-22-21-10-23-18)17(6-7-20-16)24-13-4-2-12(19)3-5-13/h2-10H,19H2,1H3 |
| InChIKey | IYPMIRQNUPDSRL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|