C28H25FN4O4 — CID 153329906
4-(4-aminophenoxy)-6-methylquinoline-7-carboxamide;N-(4-fluorophenyl)-1-formylcyclopropane-1-carboxamide (PubChem CID 153329906) has the molecular formula C28H25FN4O4 and a molecular weight of 500.53 g/mol. Its IUPAC name is 4-(4-aminophenoxy)-6-methylquinoline-7-carboxamide;N-(4-fluorophenyl)-1-formylcyclopropane-1-carboxamide.
| Compound Name | 4-(4-aminophenoxy)-6-methylquinoline-7-carboxamide;N-(4-fluorophenyl)-1-formylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 153329906 |
| Molecular Formula | C28H25FN4O4 |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 4-(4-aminophenoxy)-6-methylquinoline-7-carboxamide;N-(4-fluorophenyl)-1-formylcyclopropane-1-carboxamide |
| SMILES | Cc1cc2c(Oc3ccc(N)cc3)ccnc2cc1C(N)=O.O=CC1(C(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H15N3O2.C11H10FNO2/c1-10-8-14-15(9-13(10)17(19)21)20-7-6-16(14)22-12-4-2-11(18)3-5-12;12-8-1-3-9(4-2-8)13-10(15)11(7-14)5-6-11/h2-9H,18H2,1H3,(H2,19,21);1-4,7H,5-6H2,(H,13,15) |
| InChIKey | XOCOEMYCYURWGF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 137.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|