C20H16N2O4 — CID 143070677
6-(7-methoxyquinolin-4-yl)oxy-2-methyl-1-benzofuran-3-carboxamide (PubChem CID 143070677) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 6-(7-methoxyquinolin-4-yl)oxy-2-methyl-1-benzofuran-3-carboxamide.
| Compound Name | 6-(7-methoxyquinolin-4-yl)oxy-2-methyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 143070677 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 6-(7-methoxyquinolin-4-yl)oxy-2-methyl-1-benzofuran-3-carboxamide |
| SMILES | COc1ccc2c(Oc3ccc4c(C(N)=O)c(C)oc4c3)ccnc2c1 |
| InChI | InChI=1S/C20H16N2O4/c1-11-19(20(21)23)15-6-4-13(10-18(15)25-11)26-17-7-8-22-16-9-12(24-2)3-5-14(16)17/h3-10H,1-2H3,(H2,21,23) |
| InChIKey | URRWOLOTKQXVFC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |