C20H16N2O4 — CID 135507449
6-(7-hydroxyquinolin-4-yl)oxy-N,2-dimethyl-1-benzofuran-3-carboxamide (PubChem CID 135507449) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is 6-(7-hydroxyquinolin-4-yl)oxy-N,2-dimethyl-1-benzofuran-3-carboxamide.
| Compound Name | 6-(7-hydroxyquinolin-4-yl)oxy-N,2-dimethyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 135507449 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 6-(7-hydroxyquinolin-4-yl)oxy-N,2-dimethyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(C)oc2cc(Oc3ccnc4cc(O)ccc34)ccc12 |
| InChI | InChI=1S/C20H16N2O4/c1-11-19(20(24)21-2)15-6-4-13(10-18(15)25-11)26-17-7-8-22-16-9-12(23)3-5-14(16)17/h3-10,23H,1-2H3,(H,21,24) |
| InChIKey | SMQZOFDKBBJGHX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |