C20H19N3O5 — CID 178115189
6-[6-(dihydroxymethyl)-5-methylpyrrolo[1,2-b]pyridazin-4-yl]oxy-N,2-dimethyl-1-benzofuran-3-carboxamide (PubChem CID 178115189) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is 6-[6-(dihydroxymethyl)-5-methylpyrrolo[1,2-b]pyridazin-4-yl]oxy-N,2-dimethyl-1-benzofuran-3-carboxamide.
| Compound Name | 6-[6-(dihydroxymethyl)-5-methylpyrrolo[1,2-b]pyridazin-4-yl]oxy-N,2-dimethyl-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 178115189 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 6-[6-(dihydroxymethyl)-5-methylpyrrolo[1,2-b]pyridazin-4-yl]oxy-N,2-dimethyl-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(C)oc2cc(Oc3ccnn4cc(C(O)O)c(C)c34)ccc12 |
| InChI | InChI=1S/C20H19N3O5/c1-10-14(20(25)26)9-23-18(10)15(6-7-22-23)28-12-4-5-13-16(8-12)27-11(2)17(13)19(24)21-3/h4-9,20,25-26H,1-3H3,(H,21,24) |
| InChIKey | BRGNAGKNVJIBHI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|