C19H16N2O3 — CID 178114752
6-(5,6-dimethylpyrrolo[1,2-b]pyridazin-4-yl)oxy-2-methyl-1-benzofuran-3-carbaldehyde (PubChem CID 178114752) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 6-(5,6-dimethylpyrrolo[1,2-b]pyridazin-4-yl)oxy-2-methyl-1-benzofuran-3-carbaldehyde.
| Compound Name | 6-(5,6-dimethylpyrrolo[1,2-b]pyridazin-4-yl)oxy-2-methyl-1-benzofuran-3-carbaldehyde |
|---|---|
| PubChem CID | 178114752 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 6-(5,6-dimethylpyrrolo[1,2-b]pyridazin-4-yl)oxy-2-methyl-1-benzofuran-3-carbaldehyde |
| SMILES | Cc1cn2nccc(Oc3ccc4c(C=O)c(C)oc4c3)c2c1C |
| InChI | InChI=1S/C19H16N2O3/c1-11-9-21-19(12(11)2)17(6-7-20-21)24-14-4-5-15-16(10-22)13(3)23-18(15)8-14/h4-10H,1-3H3 |
| InChIKey | KPMLGBYGTONKEU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|