C23H30N2O3 — CID 168886816
3,3-dimethyl-1-(methylamino)butan-2-ol;7-methoxy-4-phenoxyquinoline (PubChem CID 168886816) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 3,3-dimethyl-1-(methylamino)butan-2-ol;7-methoxy-4-phenoxyquinoline.
| Compound Name | 3,3-dimethyl-1-(methylamino)butan-2-ol;7-methoxy-4-phenoxyquinoline |
|---|---|
| PubChem CID | 168886816 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 3,3-dimethyl-1-(methylamino)butan-2-ol;7-methoxy-4-phenoxyquinoline |
| SMILES | CNCC(O)C(C)(C)C.COc1ccc2c(Oc3ccccc3)ccnc2c1 |
| InChI | InChI=1S/C16H13NO2.C7H17NO/c1-18-13-7-8-14-15(11-13)17-10-9-16(14)19-12-5-3-2-4-6-12;1-7(2,3)6(9)5-8-4/h2-11H,1H3;6,8-9H,5H2,1-4H3 |
| InChIKey | NBISRSHJMFFCHM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |