C18H17BrN2O3S — CID 157040867
[3-bromo-4-[(7-methoxyquinolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane (PubChem CID 157040867) has the molecular formula C18H17BrN2O3S and a molecular weight of 421.32 g/mol. Its IUPAC name is [3-bromo-4-[(7-methoxyquinolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane.
| Compound Name | [3-bromo-4-[(7-methoxyquinolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 157040867 |
| Molecular Formula | C18H17BrN2O3S |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | [3-bromo-4-[(7-methoxyquinolin-4-yl)oxymethyl]phenyl]-imino-methyl-oxo-λ6-sulfane |
| SMILES | [H]N=S(C)(=O)c1ccc(COc2ccnc3cc(OC)ccc23)c(Br)c1 |
| InChI | InChI=1S/C18H17BrN2O3S/c1-23-13-4-6-15-17(9-13)21-8-7-18(15)24-11-12-3-5-14(10-16(12)19)25(2,20)22/h3-10,20H,11H2,1-2H3 |
| InChIKey | VCFJVJGWTDFIPD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |