C18H19NO5S — CID 170169423
methanesulfonic acid;4-(7-methoxyquinolin-4-yl)-2-methylphenol (PubChem CID 170169423) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is methanesulfonic acid;4-(7-methoxyquinolin-4-yl)-2-methylphenol.
| Compound Name | methanesulfonic acid;4-(7-methoxyquinolin-4-yl)-2-methylphenol |
|---|---|
| PubChem CID | 170169423 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | methanesulfonic acid;4-(7-methoxyquinolin-4-yl)-2-methylphenol |
| SMILES | COc1ccc2c(-c3ccc(O)c(C)c3)ccnc2c1.CS(=O)(=O)O |
| InChI | InChI=1S/C17H15NO2.CH4O3S/c1-11-9-12(3-6-17(11)19)14-7-8-18-16-10-13(20-2)4-5-15(14)16;1-5(2,3)4/h3-10,19H,1-2H3;1H3,(H,2,3,4) |
| InChIKey | CNUYCBJEVUIXDM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|