About tert-butyl N-[[4-(6,7-dimethoxyquinolin-4-yl)phenyl]methyl]-N-methylcarbamate
tert-butyl N-[[4-(6,7-dimethoxyquinolin-4-yl)phenyl]methyl]-N-methylcarbamate (PubChem CID 154630901) has the molecular formula C24H28N2O4
and a molecular weight of 408.50 g/mol. Its IUPAC name is tert-butyl N-[[4-(6,7-dimethoxyquinolin-4-yl)phenyl]methyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[4-(6,7-dimethoxyquinolin-4-yl)phenyl]methyl]-N-methylcarbamate |
| PubChem CID | 154630901 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | tert-butyl N-[[4-(6,7-dimethoxyquinolin-4-yl)phenyl]methyl]-N-methylcarbamate |
| SMILES | COc1cc2nccc(-c3ccc(CN(C)C(=O)OC(C)(C)C)cc3)c2cc1OC |
| InChI | InChI=1S/C24H28N2O4/c1-24(2,3)30-23(27)26(4)15-16-7-9-17(10-8-16)18-11-12-25-20-14-22(29-6)21(28-5)13-19(18)20/h7-14H,15H2,1-6H3 |
| InChIKey | QNHUULRFXXWMFU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[[4-(6,7-dimethoxyquinolin-4-yl)phenyl]methyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[4-(6,7-dimethoxyquinolin-4-yl)phenyl]methyl]-N-methylcarbamate?
The IUPAC name of tert-butyl N-[[4-(6,7-dimethoxyquinolin-4-yl)phenyl]methyl]-N-methylcarbamate (CID 154630901) is tert-butyl N-[[4-(6,7-dimethoxyquinolin-4-yl)phenyl]methyl]-N-methylcarbamate.
What is the SMILES notation for tert-butyl N-[[4-(6,7-dimethoxyquinolin-4-yl)phenyl]methyl]-N-methylcarbamate?
The canonical SMILES for tert-butyl N-[[4-(6,7-dimethoxyquinolin-4-yl)phenyl]methyl]-N-methylcarbamate is COc1cc2nccc(-c3ccc(CN(C)C(=O)OC(C)(C)C)cc3)c2cc1OC.
What is the InChIKey of tert-butyl N-[[4-(6,7-dimethoxyquinolin-4-yl)phenyl]methyl]-N-methylcarbamate?
The InChIKey is QNHUULRFXXWMFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N2O4/c1-24(2,3)30-23(27)26(4)15-16-7-9-17(10-8-16)18-11-12-25-20-14-22(29-6)21(28-5)13-19(18)20/h7-14H,15H2,1-6H3.
What are the key properties of tert-butyl N-[[4-(6,7-dimethoxyquinolin-4-yl)phenyl]methyl]-N-methylcarbamate?
tert-butyl N-[[4-(6,7-dimethoxyquinolin-4-yl)phenyl]methyl]-N-methylcarbamate has a molecular weight of 408.50 g/mol, XLogP of 5.29, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[4-(6,7-dimethoxyquinolin-4-yl)phenyl]methyl]-N-methylcarbamate is sourced from PubChem (CID 154630901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).