C20H21N3O3 — CID 164563752
tert-butyl N-[[4-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methyl]carbamate (PubChem CID 164563752) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is tert-butyl N-[[4-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 164563752 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | tert-butyl N-[[4-(7-oxo-8H-1,8-naphthyridin-4-yl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(-c2ccnc3[nH]c(=O)ccc23)cc1 |
| InChI | InChI=1S/C20H21N3O3/c1-20(2,3)26-19(25)22-12-13-4-6-14(7-5-13)15-10-11-21-18-16(15)8-9-17(24)23-18/h4-11H,12H2,1-3H3,(H,22,25)(H,21,23,24) |
| InChIKey | VMPWURCUXCNJSK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |