C17H15N3O5 — CID 172991567
N,2-dihydroxy-2-[4-[(7-methoxy-1,8-naphthyridin-4-yl)oxy]phenyl]acetamide (PubChem CID 172991567) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is N,2-dihydroxy-2-[4-[(7-methoxy-1,8-naphthyridin-4-yl)oxy]phenyl]acetamide.
| Compound Name | N,2-dihydroxy-2-[4-[(7-methoxy-1,8-naphthyridin-4-yl)oxy]phenyl]acetamide |
|---|---|
| PubChem CID | 172991567 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N,2-dihydroxy-2-[4-[(7-methoxy-1,8-naphthyridin-4-yl)oxy]phenyl]acetamide |
| SMILES | COc1ccc2c(Oc3ccc(C(O)C(=O)NO)cc3)ccnc2n1 |
| InChI | InChI=1S/C17H15N3O5/c1-24-14-7-6-12-13(8-9-18-16(12)19-14)25-11-4-2-10(3-5-11)15(21)17(22)20-23/h2-9,15,21,23H,1H3,(H,20,22) |
| InChIKey | HPOIJYYTKQDMND-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|