C19H19N3O5S — CID 172515933
N-hydroxy-2-[4-[(7-methoxy-1,8-naphthyridin-4-yl)sulfonyl]phenyl]-2-methylpropanamide (PubChem CID 172515933) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is N-hydroxy-2-[4-[(7-methoxy-1,8-naphthyridin-4-yl)sulfonyl]phenyl]-2-methylpropanamide.
| Compound Name | N-hydroxy-2-[4-[(7-methoxy-1,8-naphthyridin-4-yl)sulfonyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 172515933 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-hydroxy-2-[4-[(7-methoxy-1,8-naphthyridin-4-yl)sulfonyl]phenyl]-2-methylpropanamide |
| SMILES | COc1ccc2c(S(=O)(=O)c3ccc(C(C)(C)C(=O)NO)cc3)ccnc2n1 |
| InChI | InChI=1S/C19H19N3O5S/c1-19(2,18(23)22-24)12-4-6-13(7-5-12)28(25,26)15-10-11-20-17-14(15)8-9-16(21-17)27-3/h4-11,24H,1-3H3,(H,22,23) |
| InChIKey | RZOXLFLHWRYXDJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|