C17H14FN3O4 — CID 172515971
2-[3-fluoro-4-[(7-methoxy-1,8-naphthyridin-4-yl)oxy]phenyl]-N-hydroxyacetamide (PubChem CID 172515971) has the molecular formula C17H14FN3O4 and a molecular weight of 343.31 g/mol. Its IUPAC name is 2-[3-fluoro-4-[(7-methoxy-1,8-naphthyridin-4-yl)oxy]phenyl]-N-hydroxyacetamide.
| Compound Name | 2-[3-fluoro-4-[(7-methoxy-1,8-naphthyridin-4-yl)oxy]phenyl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 172515971 |
| Molecular Formula | C17H14FN3O4 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-[3-fluoro-4-[(7-methoxy-1,8-naphthyridin-4-yl)oxy]phenyl]-N-hydroxyacetamide |
| SMILES | COc1ccc2c(Oc3ccc(CC(=O)NO)cc3F)ccnc2n1 |
| InChI | InChI=1S/C17H14FN3O4/c1-24-16-5-3-11-13(6-7-19-17(11)20-16)25-14-4-2-10(8-12(14)18)9-15(22)21-23/h2-8,23H,9H2,1H3,(H,21,22) |
| InChIKey | GQZJVKCYJAAPDC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|