C16H13F2N2O5P — CID 176510975
[2,6-difluoro-4-[(7-methoxy-1,8-naphthyridin-4-yl)oxy]phenyl]methylphosphonic acid (PubChem CID 176510975) has the molecular formula C16H13F2N2O5P and a molecular weight of 382.26 g/mol. Its IUPAC name is [2,6-difluoro-4-[(7-methoxy-1,8-naphthyridin-4-yl)oxy]phenyl]methylphosphonic acid.
| Compound Name | [2,6-difluoro-4-[(7-methoxy-1,8-naphthyridin-4-yl)oxy]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 176510975 |
| Molecular Formula | C16H13F2N2O5P |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | [2,6-difluoro-4-[(7-methoxy-1,8-naphthyridin-4-yl)oxy]phenyl]methylphosphonic acid |
| SMILES | COc1ccc2c(Oc3cc(F)c(CP(=O)(O)O)c(F)c3)ccnc2n1 |
| InChI | InChI=1S/C16H13F2N2O5P/c1-24-15-3-2-10-14(4-5-19-16(10)20-15)25-9-6-12(17)11(13(18)7-9)8-26(21,22)23/h2-7H,8H2,1H3,(H2,21,22,23) |
| InChIKey | IURSSLZZCLFRAO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 101.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|