C16H14F2N3O4P — CID 177089317
[2,6-difluoro-4-[(7-methoxy-1,6-naphthyridin-4-yl)amino]phenyl]methylphosphonic acid (PubChem CID 177089317) has the molecular formula C16H14F2N3O4P and a molecular weight of 381.28 g/mol. Its IUPAC name is [2,6-difluoro-4-[(7-methoxy-1,6-naphthyridin-4-yl)amino]phenyl]methylphosphonic acid.
| Compound Name | [2,6-difluoro-4-[(7-methoxy-1,6-naphthyridin-4-yl)amino]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 177089317 |
| Molecular Formula | C16H14F2N3O4P |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | [2,6-difluoro-4-[(7-methoxy-1,6-naphthyridin-4-yl)amino]phenyl]methylphosphonic acid |
| SMILES | COc1cc2nccc(Nc3cc(F)c(CP(=O)(O)O)c(F)c3)c2cn1 |
| InChI | InChI=1S/C16H14F2N3O4P/c1-25-16-6-15-10(7-20-16)14(2-3-19-15)21-9-4-12(17)11(13(18)5-9)8-26(22,23)24/h2-7H,8H2,1H3,(H,19,21)(H2,22,23,24) |
| InChIKey | RXKYNNNOADUBBM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|