C18H13FN2OS — CID 156804987
2-fluoro-4-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]phenol (PubChem CID 156804987) has the molecular formula C18H13FN2OS and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-fluoro-4-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]phenol.
| Compound Name | 2-fluoro-4-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]phenol |
|---|---|
| PubChem CID | 156804987 |
| Molecular Formula | C18H13FN2OS |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-fluoro-4-[(2-methylthieno[2,3-g]quinolin-8-yl)amino]phenol |
| SMILES | Cc1cc2cc3nccc(Nc4ccc(O)c(F)c4)c3cc2s1 |
| InChI | InChI=1S/C18H13FN2OS/c1-10-6-11-7-16-13(9-18(11)23-10)15(4-5-20-16)21-12-2-3-17(22)14(19)8-12/h2-9,22H,1H3,(H,20,21) |
| InChIKey | HDKSWZVEMITWBN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|