C16H15N4O3S- — CID 155099868
2-methoxy-5-[[4-(sulfinatoamino)phenyl]methylamino]-1,8-naphthyridine (PubChem CID 155099868) has the molecular formula C16H15N4O3S- and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-methoxy-5-[[4-(sulfinatoamino)phenyl]methylamino]-1,8-naphthyridine.
| Compound Name | 2-methoxy-5-[[4-(sulfinatoamino)phenyl]methylamino]-1,8-naphthyridine |
|---|---|
| PubChem CID | 155099868 |
| Molecular Formula | C16H15N4O3S- |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-methoxy-5-[[4-(sulfinatoamino)phenyl]methylamino]-1,8-naphthyridine |
| SMILES | COc1ccc2c(NCc3ccc(NS(=O)[O-])cc3)ccnc2n1 |
| InChI | InChI=1S/C16H16N4O3S/c1-23-15-7-6-13-14(8-9-17-16(13)19-15)18-10-11-2-4-12(5-3-11)20-24(21)22/h2-9,20H,10H2,1H3,(H,21,22)(H,17,18,19)/p-1 |
| InChIKey | BRCQHEXNMANUDT-UHFFFAOYSA-M |
| XLogP | 2.46 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|