C18H18N2O — CID 178086355
8-methoxy-N-[(4-methylphenyl)methyl]quinolin-4-amine (PubChem CID 178086355) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 8-methoxy-N-[(4-methylphenyl)methyl]quinolin-4-amine.
| Compound Name | 8-methoxy-N-[(4-methylphenyl)methyl]quinolin-4-amine |
|---|---|
| PubChem CID | 178086355 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 8-methoxy-N-[(4-methylphenyl)methyl]quinolin-4-amine |
| SMILES | COc1cccc2c(NCc3ccc(C)cc3)ccnc12 |
| InChI | InChI=1S/C18H18N2O/c1-13-6-8-14(9-7-13)12-20-16-10-11-19-18-15(16)4-3-5-17(18)21-2/h3-11H,12H2,1-2H3,(H,19,20) |
| InChIKey | BMMRQHPCYQCFJE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |