C17H21F2N3O2 — CID 138585653
2,2-difluoro-N-[5-[(8-methoxyquinolin-4-yl)amino]pentyl]acetamide (PubChem CID 138585653) has the molecular formula C17H21F2N3O2 and a molecular weight of 337.37 g/mol. Its IUPAC name is 2,2-difluoro-N-[5-[(8-methoxyquinolin-4-yl)amino]pentyl]acetamide.
| Compound Name | 2,2-difluoro-N-[5-[(8-methoxyquinolin-4-yl)amino]pentyl]acetamide |
|---|---|
| PubChem CID | 138585653 |
| Molecular Formula | C17H21F2N3O2 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2,2-difluoro-N-[5-[(8-methoxyquinolin-4-yl)amino]pentyl]acetamide |
| SMILES | COc1cccc2c(NCCCCCNC(=O)C(F)F)ccnc12 |
| InChI | InChI=1S/C17H21F2N3O2/c1-24-14-7-5-6-12-13(8-11-21-15(12)14)20-9-3-2-4-10-22-17(23)16(18)19/h5-8,11,16H,2-4,9-10H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | VPHPKWQUOILYAA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|