5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate

C16H21N3O4 — CID 135260708

IUPAC5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate
SMILESCOCc1cccc2c(NCCCCCO[N+](=O)[O-])ccnc12
InChIInChI=1S/C16H21N3O4/c1-22-12-13-6-5-7-14-15(8-10-18-16(13)14)17-9-3-2-4-11-23-19(20)21/h5-8,10H,2-4,9,11-12H2,1H3,(H,17,18)
InChIKeyQFMAMWHNHMQJHN-UHFFFAOYSA-N
MW319.36 g/mol
LogP3.17
Rot. Bonds10

About 5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate

5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate (PubChem CID 135260708) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate.

Molecular Properties

Compound Name5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate
PubChem CID135260708
Molecular FormulaC16H21N3O4
Molecular Weight319.36 g/mol
Exact Mass319.15
IUPAC Name5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate
SMILESCOCc1cccc2c(NCCCCCO[N+](=O)[O-])ccnc12
InChIInChI=1S/C16H21N3O4/c1-22-12-13-6-5-7-14-15(8-10-18-16(13)14)17-9-3-2-4-11-23-19(20)21/h5-8,10H,2-4,9,11-12H2,1H3,(H,17,18)
InChIKeyQFMAMWHNHMQJHN-UHFFFAOYSA-N
XLogP3.17
TPSA86.52 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds10
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.36
LogP ≤ 53.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate?
The IUPAC name of 5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate (CID 135260708) is 5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate.
What is the SMILES notation for 5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate?
The canonical SMILES for 5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate is COCc1cccc2c(NCCCCCO[N+](=O)[O-])ccnc12.
What is the InChIKey of 5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate?
The InChIKey is QFMAMWHNHMQJHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O4/c1-22-12-13-6-5-7-14-15(8-10-18-16(13)14)17-9-3-2-4-11-23-19(20)21/h5-8,10H,2-4,9,11-12H2,1H3,(H,17,18).
What are the key properties of 5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate?
5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate has a molecular weight of 319.36 g/mol, XLogP of 3.17, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate is sourced from PubChem (CID 135260708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).