C16H21N3O4 — CID 135260708
5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate (PubChem CID 135260708) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate.
| Compound Name | 5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate |
|---|---|
| PubChem CID | 135260708 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 5-[[8-(methoxymethyl)quinolin-4-yl]amino]pentyl nitrate |
| SMILES | COCc1cccc2c(NCCCCCO[N+](=O)[O-])ccnc12 |
| InChI | InChI=1S/C16H21N3O4/c1-22-12-13-6-5-7-14-15(8-10-18-16(13)14)17-9-3-2-4-11-23-19(20)21/h5-8,10H,2-4,9,11-12H2,1H3,(H,17,18) |
| InChIKey | QFMAMWHNHMQJHN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|