C18H19N3O2S — CID 166845406
4-[[(7-methoxyquinolin-4-yl)amino]methyl]-N-methylbenzenesulfinamide (PubChem CID 166845406) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 4-[[(7-methoxyquinolin-4-yl)amino]methyl]-N-methylbenzenesulfinamide.
| Compound Name | 4-[[(7-methoxyquinolin-4-yl)amino]methyl]-N-methylbenzenesulfinamide |
|---|---|
| PubChem CID | 166845406 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 4-[[(7-methoxyquinolin-4-yl)amino]methyl]-N-methylbenzenesulfinamide |
| SMILES | CNS(=O)c1ccc(CNc2ccnc3cc(OC)ccc23)cc1 |
| InChI | InChI=1S/C18H19N3O2S/c1-19-24(22)15-6-3-13(4-7-15)12-21-17-9-10-20-18-11-14(23-2)5-8-16(17)18/h3-11,19H,12H2,1-2H3,(H,20,21) |
| InChIKey | AZFCVCNBUMGLRJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |